CID 137944659
Modify Date: 2026-08-02 20:03:35
CID 137944659 structure
|
Common Name | CID 137944659 | ||
|---|---|---|---|---|
| CAS Number | 2287237-10-7 | Molecular Weight | 301.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 137944659 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H19NO4 |
|---|---|
| Molecular Weight | 301.34 |
| InChIKey | XAEBGHJNKQUNGQ-XJIUQZFPSA-N |
| SMILES | O=C(OCc1ccccc1)N1C2CCC1C1CC1(C(=O)O)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of CID 137944659? |
| A: SMILES notation of CID 137944659 is O=C(OCc1ccccc1)N1C2CCC1C1CC1(C(=O)O)C2. |
| Q: What is the Chinese name of 2287237-10-7? |
| A: Chinese name of 2287237-10-7 is 2287237-10-7. |
| Q: What is the English name of CID 137944659? |
| A: The English name of CID 137944659 is CID 137944659. |
| Q: What is the molecular weight of CID 137944659? |
| A: Molecular weight of CID 137944659 is 301.34. |
| Q: What is the InChIKey of CID 137944659? |
| A: InChIKey of CID 137944659 is XAEBGHJNKQUNGQ-XJIUQZFPSA-N. |
| Q: What is the molecular formula of CID 137944659? |
| A: Molecular formula of CID 137944659 is C17H19NO4. |
| Q: What is the CAS number of CID 137944659? |
| A: CAS number of CID 137944659 is 2287237-10-7. |