CID 137943839
Modify Date: 2026-07-03 09:37:18
CID 137943839 structure
|
Common Name | CID 137943839 | ||
|---|---|---|---|---|
| CAS Number | 2287237-75-4 | Molecular Weight | 317.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 137943839 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H24ClN5O2 |
|---|---|
| Molecular Weight | 317.81 |
| InChIKey | XBZBNNIEWDPYOL-MERQFXBCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1Cn1cc(CN)nn1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of CID 137943839? |
| A: The English name of CID 137943839 is CID 137943839. |
| Q: What is the molecular weight of CID 137943839? |
| A: Molecular weight of CID 137943839 is 317.81. |
| Q: What is the Chinese name of 2287237-75-4? |
| A: Chinese name of 2287237-75-4 is 2287237-75-4. |
| Q: What is the CAS number of CID 137943839? |
| A: CAS number of CID 137943839 is 2287237-75-4. |
| Q: What is the SMILES notation of CID 137943839? |
| A: SMILES notation of CID 137943839 is CC(C)(C)OC(=O)N1CCCC1Cn1cc(CN)nn1.Cl. |
| Q: What is the molecular formula of CID 137943839? |
| A: Molecular formula of CID 137943839 is C13H24ClN5O2. |
| Q: What is the InChIKey of CID 137943839? |
| A: InChIKey of CID 137943839 is XBZBNNIEWDPYOL-MERQFXBCSA-N. |