[3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol
Modify Date: 2025-09-06 19:22:23
![[3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol Structure](https://www.chemsrc.com/extcaspic/426/2287342-10-1.png)
[3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol structure
|
Common Name | [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 2287342-10-1 | Molecular Weight | 228.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11F3O |
|---|---|
| Molecular Weight | 228.21 |
| InChIKey | UDDLPJGNBHKXAD-UHFFFAOYSA-N |
| SMILES | OCC12CC(c3cc(F)c(F)c(F)c3)(C1)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol? |
| A: Molecular weight of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol is 228.21. |
| Q: What is the InChIKey of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol? |
| A: InChIKey of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol is UDDLPJGNBHKXAD-UHFFFAOYSA-N. |
| Q: What is the English name of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol? |
| A: The English name of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol is [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol. |
| Q: What is the SMILES notation of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol? |
| A: SMILES notation of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol is OCC12CC(c3cc(F)c(F)c(F)c3)(C1)C2. |
| Q: What is the Chinese name of 2287342-10-1? |
| A: Chinese name of 2287342-10-1 is 2287342-10-1. |
| Q: What is the CAS number of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol? |
| A: CAS number of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol is 2287342-10-1. |
| Q: What is the molecular formula of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol? |
| A: Molecular formula of [3-(3,4,5-Trifluorophenyl)-1-bicyclo[1.1.1]pentanyl]methanol is C12H11F3O. |