Propanedioic acid,2-(1-methylethenyl)-2-(2-propen-1-yl)-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-(1-methylethenyl)-2-(2-propen-1-yl)-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 22902-20-1 | Molecular Weight | 240.29500 | |
| Density | 1g/cm3 | Boiling Point | 274.7ºC at 760mmHg | |
| Molecular Formula | C13H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.6ºC | |
| Name | Allyl-isobutyl-malonsaeure-diaethylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 274.7ºC at 760mmHg |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.29500 |
| Flash Point | 122.6ºC |
| Exact Mass | 240.13600 |
| PSA | 52.60000 |
| LogP | 2.25120 |
| Vapour Pressure | 0.00533mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | SAZXJJYCVCSNSR-UHFFFAOYSA-N |
| SMILES | C=CCC(C(=C)C)(C(=O)OCC)C(=O)OCC |
| HS Code | 2917190090 |
|---|
|
~%
Propanedioic ac... CAS#:22902-20-1 |
| Literature: Cope; Hancock Journal of the American Chemical Society, 1938 , vol. 60, p. 2646 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| allyl-isobutyl-malonic acid diethyl ester |
| Isobutyl-allyl-malonsaeurediethylester |
| Allyl-isopropenyl-malonsaeure-diaethylester |
| Diethyl allylisobutylmalonate |
| allyl-isopropenyl-malonic acid diethyl ester |
| diethyl 2-isobutyl-2-(prop-2-enyl)malonate |