Ethyl 5-(((5-nitro-2-furanyl)methylene)amino)-2-furancarboxylate structure
|
Common Name | Ethyl 5-(((5-nitro-2-furanyl)methylene)amino)-2-furancarboxylate | ||
|---|---|---|---|---|
| CAS Number | 22929-69-7 | Molecular Weight | 278.21800 | |
| Density | 1.42g/cm3 | Boiling Point | 449ºC at 760mmHg | |
| Molecular Formula | C12H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4ºC | |
| Name | ethyl 5-[(5-nitrofuran-2-yl)methylideneamino]furan-2-carboxylate |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 449ºC at 760mmHg |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.21800 |
| Flash Point | 225.4ºC |
| Exact Mass | 278.05400 |
| PSA | 110.76000 |
| LogP | 3.23130 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | KQCOIYUNTWBYQW-NTUHNPAUSA-N |
| SMILES | CCOC(=O)c1ccc(N=Cc2ccc([N+](=O)[O-])o2)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |