(5-methoxy-1H-indol-2-yl)(piperidin-1-yl)methanone structure
|
Common Name | (5-methoxy-1H-indol-2-yl)(piperidin-1-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 22930-55-8 | Molecular Weight | 258.31600 | |
| Density | 1.224g/cm3 | Boiling Point | 477.4ºC at 760mmHg | |
| Molecular Formula | C15H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.6ºC | |
| Name | (5-methoxy-1H-indol-2-yl)-piperidin-1-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 477.4ºC at 760mmHg |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.31600 |
| Flash Point | 242.6ºC |
| Exact Mass | 258.13700 |
| PSA | 45.33000 |
| LogP | 2.74050 |
| Vapour Pressure | 2.8E-09mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | WNUGVHMANDXOOZ-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(C(=O)N3CCCCC3)cc2c1 |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD01700487 |