pH-Low Insertion Peptide
Modify Date: 2025-08-25 13:05:00
pH-Low Insertion Peptide structure
|
Common Name | pH-Low Insertion Peptide | ||
|---|---|---|---|---|
| CAS Number | 2293160-09-3 | Molecular Weight | 4052.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C189H28N4O55S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of pH-Low Insertion PeptidepH-Low Insertion Peptide (pHLIP) used as a specific ligand to target the tumor acidic microenvironment for tumors at early and metastatic stages[1]. |
| Name | pH-Low Insertion Peptide |
|---|
| Description | pH-Low Insertion Peptide (pHLIP) used as a specific ligand to target the tumor acidic microenvironment for tumors at early and metastatic stages[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C189H28N4O55S |
|---|---|
| Molecular Weight | 4052.03 |
| InChIKey | GHOAMUSBZVQHHQ-XRCOSKEGSA-N |
| SMILES | CCC(C)C(NC(=O)C1CCCN1C(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C(CCC(=O)O)NC(=O)C(CS)NC(=O)C(C)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(C)C)C(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CC(=O)O)C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(CC(=O)O)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)O)C(C)O)C(C)C)C(C)O)C(C)O |