6-chloro-4-N-ethyl-2-N-(3-methylbutan-2-yl)-1,3,5-triazine-2,4-diamine structure
|
Common Name | 6-chloro-4-N-ethyl-2-N-(3-methylbutan-2-yl)-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 22936-69-2 | Molecular Weight | 243.73600 | |
| Density | 1.199g/cm3 | Boiling Point | 385.4ºC at 760 mmHg | |
| Molecular Formula | C10H18ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.9ºC | |
| Name | 6-chloro-4-N-ethyl-2-N-(3-methylbutan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 385.4ºC at 760 mmHg |
| Molecular Formula | C10H18ClN5 |
| Molecular Weight | 243.73600 |
| Flash Point | 186.9ºC |
| Exact Mass | 243.12500 |
| PSA | 69.19000 |
| LogP | 1.25700 |
| Vapour Pressure | 3.81E-06mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | KUSIBZBALUOJHM-UHFFFAOYSA-N |
| SMILES | CCNc1nc(Cl)nc(NC(C)C(C)C)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |