Benzene,2-[(4-chlorophenyl)sulfonyl]-1,3,5-trimethyl structure
|
Common Name | Benzene,2-[(4-chlorophenyl)sulfonyl]-1,3,5-trimethyl | ||
|---|---|---|---|---|
| CAS Number | 22944-35-0 | Molecular Weight | 294.79600 | |
| Density | 1.235g/cm3 | Boiling Point | 438.8ºC at 760 mmHg | |
| Molecular Formula | C15H15ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.2ºC | |
| Name | 2-(4-chlorophenyl)sulfonyl-1,3,5-trimethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 438.8ºC at 760 mmHg |
| Molecular Formula | C15H15ClO2S |
| Molecular Weight | 294.79600 |
| Flash Point | 219.2ºC |
| Exact Mass | 294.04800 |
| PSA | 42.52000 |
| LogP | 5.17880 |
| Vapour Pressure | 1.72E-07mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | YIFXGYRAAXGFIS-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2ccc(Cl)cc2)c(C)c1 |
|
~%
Benzene,2-[(4-c... CAS#:22944-35-0 |
| Literature: Truce,W.E.; Guy,M.M. Journal of Organic Chemistry, 1961 , vol. 26, p. 4331 - 4336 |
|
~%
Benzene,2-[(4-c... CAS#:22944-35-0 |
| Literature: Grant, Douglas W.; Hogg, Donald R.; Wardell, James L. Journal of Chemical Research, Miniprint, 1987 , # 12 p. 3123 - 3143 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4'-Chlor-2,4,6-trimethyl-diphenylsulfon |