tris(4-methylsulfanylphenyl) phosphite
tris(4-methylsulfanylphenyl) phosphite structure
|
Common Name | tris(4-methylsulfanylphenyl) phosphite | ||
|---|---|---|---|---|
| CAS Number | 22945-49-9 | Molecular Weight | 448.55800 | |
| Density | N/A | Boiling Point | 525.1ºC at 760 mmHg | |
| Molecular Formula | C21H21O3PS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.4ºC | |
Summary: Tris(4-methylsulfanylphenyl) phosphite, with CAS number 22945-49-9, has a molecular formula of C21H21O3PS3 and a molecular weight of 448.56. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tris(4-methylsulfanylphenyl) phosphite |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 525.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C21H21O3PS3 |
| Molecular Weight | 448.55800 |
| Flash Point | 271.4ºC |
| Exact Mass | 448.03900 |
| PSA | 117.18000 |
| LogP | 7.61600 |
| Vapour Pressure | 1.36E-10mmHg at 25°C |
| InChIKey | ZQKUPMBUKWVNJW-UHFFFAOYSA-N |
| SMILES | CSc1ccc(OP(Oc2ccc(SC)cc2)Oc2ccc(SC)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
tris(4-methylsu... CAS#:22945-49-9 |
| Literature: Sienczyk, Marcin; Winiarski, Lukasz; Kasperkiewicz, Paulina; Psurski, Mateusz; Wietrzyk, Joanna; Oleksyszyn, Jozef Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 5 p. 1310 - 1314 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tris(4-methylsulfanylphenyl) phosphite? |
| A: Molecular weight of tris(4-methylsulfanylphenyl) phosphite is 448.55800. |
| Q: What is the Chinese name of 22945-49-9? |
| A: Chinese name of 22945-49-9 is 22945-49-9. |
| Q: What are the upstream materials of tris(4-methylsulfanylphenyl) phosphite? |
| A: Related upstream materials(CAS) of tris(4-methylsulfanylphenyl) phosphite: 1073-72-9. |
| Q: What is the boiling point of tris(4-methylsulfanylphenyl) phosphite? |
| A: Boiling point of tris(4-methylsulfanylphenyl) phosphite is 525.1ºC at 760 mmHg. |
| Q: What is the English name of tris(4-methylsulfanylphenyl) phosphite? |
| A: The English name of tris(4-methylsulfanylphenyl) phosphite is tris(4-methylsulfanylphenyl) phosphite. |
| Q: What is the InChIKey of tris(4-methylsulfanylphenyl) phosphite? |
| A: InChIKey of tris(4-methylsulfanylphenyl) phosphite is ZQKUPMBUKWVNJW-UHFFFAOYSA-N. |
| Q: What is the LogP of tris(4-methylsulfanylphenyl) phosphite? |
| A: LogP of tris(4-methylsulfanylphenyl) phosphite is 7.61600. |
| Q: What is the polar surface area (PSA) of tris(4-methylsulfanylphenyl) phosphite? |
| A: Polar surface area (PSA) of tris(4-methylsulfanylphenyl) phosphite is 117.18000. |
| Q: What is the SMILES notation of tris(4-methylsulfanylphenyl) phosphite? |
| A: SMILES notation of tris(4-methylsulfanylphenyl) phosphite is CSc1ccc(OP(Oc2ccc(SC)cc2)Oc2ccc(SC)cc2)cc1. |
| Q: What is the CAS number of tris(4-methylsulfanylphenyl) phosphite? |
| A: CAS number of tris(4-methylsulfanylphenyl) phosphite is 22945-49-9. |