1H-Indole-3-propanoicacid, 1-acetyl- structure
|
Common Name | 1H-Indole-3-propanoicacid, 1-acetyl- | ||
|---|---|---|---|---|
| CAS Number | 22949-13-9 | Molecular Weight | 231.24700 | |
| Density | 1.23g/cm3 | Boiling Point | 414.1ºC at 760mmHg | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.3ºC | |
| Name | 3-(1-acetylindol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 414.1ºC at 760mmHg |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.24700 |
| Flash Point | 204.3ºC |
| Exact Mass | 231.09000 |
| PSA | 59.30000 |
| LogP | 2.31860 |
| Vapour Pressure | 1.33E-07mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | DXQFXWYBFSJKRK-UHFFFAOYSA-N |
| SMILES | CC(=O)n1cc(CCC(=O)O)c2ccccc21 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(1-Acetylindol-3-yl)-propionsaeure |
| 3-(1-Acetyl-3-indolyl)propionic acid |
| 3-(1-acetyl-indol-3-yl)-propionic acid |
| 3-<(N-Acetyl)-3'-indolyl>-propionsaeure |
| 1H-Indole-3-propanoicacid,1-acetyl |
| Indole-3-propionicacid,1-acetyl-(8CI) |