1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene
![1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene Structure](https://image.chemsrc.com/caspic/204/22952-14-3.png)
1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene structure
|
Common Name | 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 22952-14-3 | Molecular Weight | 338.44200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene (CAS: 22952-14-3), molecular formula C16H18O4S2, molecular weight 338.44200, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18O4S2 |
|---|---|
| Molecular Weight | 338.44200 |
| Exact Mass | 338.06500 |
| PSA | 85.04000 |
| LogP | 4.71260 |
| InChIKey | ATPZFDFVYMLXFX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CCS(=O)(=O)c2ccc(C)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 5 | |
CAS#:106-45-6![1-methyl-4-[2-(4-methylphenyl)sulfanylethylsulfanyl]benzene Structure](https://image.chemsrc.com/caspic/279/3238-95-7.png)
CAS#:3238-95-7
CAS#:80-41-1
CAS#:5535-52-4
CAS#:38674-90-7
CAS#:15310-28-8![1-methyl-4-[(E)-2-(4-methylphenyl)sulfanylethenyl]sulfanyl-benzene Structure](https://image.chemsrc.com/caspic/407/5324-85-6.png)
CAS#:5324-85-6![1-methyl-4-[2-(4-methylphenyl)sulfanylethynylsulfanyl]benzene Structure](https://image.chemsrc.com/caspic/026/86148-27-8.png)
CAS#:86148-27-8
CAS#:861320-15-2
CAS#:536-57-2
CAS#:64-17-5
CAS#:35777-35-6
CAS#:22381-54-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1.2-Di-p-tolylsulfon-aethan |
| 1,2-ditosylate-ethane |
| 1.2-Bis-p-tolylsulfon-aethan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene? |
| A: The English name of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene is 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene. |
| Q: What is the Chinese name of 22952-14-3? |
| A: Chinese name of 22952-14-3 is 22952-14-3. |
| Q: What is the molecular weight of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene? |
| A: Molecular weight of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene is 338.44200. |
| Q: What is the molecular formula of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene? |
| A: Molecular formula of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene is C16H18O4S2. |
| Q: What are the downstream products of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene? |
| A: Related downstream products(CAS) of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene: 536-57-2;64-17-5;106-45-6;35777-35-6;22381-54-0. |
| Q: What are the upstream materials of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene? |
| A: Related upstream materials(CAS) of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene: 106-45-6;3238-95-7;80-41-1;5535-52-4;38674-90-7;15310-28-8;5324-85-6;86148-27-8;861320-15-2;536-57-2. |
| Q: What English synonyms does 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene have? |
| A: English synonyms of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene: 1.2-Di-p-tolylsulfon-aethan, 1,2-ditosylate-ethane, 1.2-Bis-p-tolylsulfon-aethan. |
| Q: What is the CAS number of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene? |
| A: CAS number of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene is 22952-14-3. |
| Q: What is the InChIKey of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene? |
| A: InChIKey of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene is ATPZFDFVYMLXFX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene? |
| A: SMILES notation of 1-methyl-4-[2-(4-methylphenyl)sulfonylethylsulfonyl]benzene is Cc1ccc(S(=O)(=O)CCS(=O)(=O)c2ccc(C)cc2)cc1. |