1,2-Benzisothiazol-3(2H)-one,5-nitro-, 1,1-dioxide structure
|
Common Name | 1,2-Benzisothiazol-3(2H)-one,5-nitro-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 22952-20-1 | Molecular Weight | 228.18200 | |
| Density | 1.762g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H4N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-nitro-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.762g/cm3 |
|---|---|
| Molecular Formula | C7H4N2O5S |
| Molecular Weight | 228.18200 |
| Exact Mass | 227.98400 |
| PSA | 117.44000 |
| LogP | 1.95970 |
| Index of Refraction | 1.662 |
| InChIKey | KABUZPWVPGUDIR-UHFFFAOYSA-N |
| SMILES | O=C1NS(=O)(=O)c2ccc([N+](=O)[O-])cc21 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-nitro-1,2-benzisothiazol-3(2H)-one 1,1-dioxide |
| 5-nitrosaccharine |