3-Chloro-4-methoxybenzene-1-sulfonyl chloride structure
|
Common Name | 3-Chloro-4-methoxybenzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 22952-43-8 | Molecular Weight | 241.09200 | |
| Density | 1.488g/cm3 | Boiling Point | 352.163ºC at 760 mmHg | |
| Molecular Formula | C7H6Cl2O3S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 166.782ºC | |
| Name | 3-Chloro-4-methoxybenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.488g/cm3 |
|---|---|
| Boiling Point | 352.163ºC at 760 mmHg |
| Molecular Formula | C7H6Cl2O3S |
| Molecular Weight | 241.09200 |
| Flash Point | 166.782ºC |
| Exact Mass | 239.94100 |
| PSA | 51.75000 |
| LogP | 3.35690 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | UMTPXDWZAKJPNY-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)Cl)cc1Cl |
| HS Code | 2909309090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-Chlor-4-methoxy-benzolsulfochlorid |
| Benzenesulfonyl chloride,3-chloro-4-methoxy |
| 3-Chloro-4-methoxybenzene-1-sulfonyl chloride |
| 3-chloro-4-methoxy-benzenesulfonyl chloride |
| 3-chloro-4-methoxybezenesulfonyl chloride |
| 3-Chlor-4-methoxy-benzolsulfonylchlorid |