4-[Bis(2-bromoethyl)amino]phenyl=4-methoxybenzoate structure
|
Common Name | 4-[Bis(2-bromoethyl)amino]phenyl=4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 22953-40-8 | Molecular Weight | 457.15600 | |
| Density | 1.553g/cm3 | Boiling Point | 540.9ºC at 760mmHg | |
| Molecular Formula | C18H19Br2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281ºC | |
| Name | [4-[bis(2-bromoethyl)amino]phenyl] 4-methoxybenzoate |
|---|
| Density | 1.553g/cm3 |
|---|---|
| Boiling Point | 540.9ºC at 760mmHg |
| Molecular Formula | C18H19Br2NO3 |
| Molecular Weight | 457.15600 |
| Flash Point | 281ºC |
| Exact Mass | 454.97300 |
| PSA | 38.77000 |
| LogP | 4.51060 |
| Vapour Pressure | 9.11E-12mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | FZDWNMZVOSEQPI-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Oc2ccc(N(CCBr)CCBr)cc2)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |