Acetamide,N-[3-[bis[2-[(methylsulfonyl)oxy]ethyl]amino]phenyl]- structure
|
Common Name | Acetamide,N-[3-[bis[2-[(methylsulfonyl)oxy]ethyl]amino]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 22964-45-0 | Molecular Weight | 394.46400 | |
| Density | 1.402g/cm3 | Boiling Point | 709.6ºC at 760 mmHg | |
| Molecular Formula | C14H22N2O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 382.9ºC | |
| Name | N,N-bis(2-(methylsulfonyloxy)ethyl)-3-acetamidoaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 709.6ºC at 760 mmHg |
| Molecular Formula | C14H22N2O7S2 |
| Molecular Weight | 394.46400 |
| Flash Point | 382.9ºC |
| Exact Mass | 394.08700 |
| PSA | 135.84000 |
| LogP | 2.63840 |
| Vapour Pressure | 5.54E-20mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | JKIKOACAXPEUOC-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)c1 |
| HS Code | 2924299090 |
|---|
|
~62%
Acetamide,N-[3-... CAS#:22964-45-0 |
| Literature: Lin, Song-Wen; Sun, Qi; Ge, Ze-Mei; Wang, Xin; Ye, Jia; Li, Run-Tao Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 3 p. 940 - 943 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-[Bis[2-[(methylsulfonyl)oxy]ethyl]amino]acetanilide |