Phosphinothioicchloride, bis(hexahydro-1H-azepin-1-yl)- (7CI,8CI) structure
|
Common Name | Phosphinothioicchloride, bis(hexahydro-1H-azepin-1-yl)- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 22965-06-6 | Molecular Weight | 294.82400 | |
| Density | 1.18g/cm3 | Boiling Point | 381.1ºC at 760mmHg | |
| Molecular Formula | C12H24ClN2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.3ºC | |
| Name | bis(azepan-1-yl)-chloro-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 381.1ºC at 760mmHg |
| Molecular Formula | C12H24ClN2PS |
| Molecular Weight | 294.82400 |
| Flash Point | 184.3ºC |
| Exact Mass | 294.10900 |
| PSA | 48.38000 |
| LogP | 4.72810 |
| Vapour Pressure | 5.21E-06mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | QRMLYXQAKILHHW-UHFFFAOYSA-N |
| SMILES | S=P(Cl)(N1CCCCCC1)N1CCCCCC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| diazepan-1-ylphosphinothioic chloride |