2-Propen-1-one,3-(3,4-dichlorophenyl)-1-phenyl-, (2E) structure
|
Common Name | 2-Propen-1-one,3-(3,4-dichlorophenyl)-1-phenyl-, (2E) | ||
|---|---|---|---|---|
| CAS Number | 22966-16-1 | Molecular Weight | 277.14500 | |
| Density | 1.296g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C15H10Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1ºC | |
| Name | (E)-3-(3,4-dichlorophenyl)-1-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Molecular Formula | C15H10Cl2O |
| Molecular Weight | 277.14500 |
| Flash Point | 176.1ºC |
| Exact Mass | 276.01100 |
| PSA | 17.07000 |
| LogP | 4.88950 |
| Vapour Pressure | 3.65E-07mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | QWYKPZUFPSREFT-VQHVLOKHSA-N |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)c1ccccc1 |
|
~97%
2-Propen-1-one,... CAS#:22966-16-1 |
| Literature: Zhang, Ze; Dong, Ya-Wei; Wang, Guan-Wu Chemistry Letters, 2003 , vol. 32, # 10 p. 966 - 967 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Safety index, ratio of IC50 for human kidney epithelial cells to IC50 for Entamoeba h...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL1019310
|
| 3,4-dichloro-trans-chalcone |
| 3,4-dichloro-thiobenzamide |
| 3,4-Dichlor-thiobenzamid |
| 3,4-Dichlor-trans-chalkon |
| 3-(3,4-dichlorophenyl)-1-phenyl-2-propen-1-one |
| 3,4-dichlorobenzene-1-carbothioamide |
| amino(3,4-dichlorophenyl)methane-1-thione |
| 3,4-Difluorchalcon |