4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid
Modify Date: 2026-07-23 00:22:47
![4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid Structure](https://www.chemsrc.com/extcaspic/414/2296957-33-8.png)
4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid structure
|
Common Name | 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2296957-33-8 | Molecular Weight | 271.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H25NO4 |
|---|---|
| Molecular Weight | 271.35 |
| InChIKey | AMXZHUBHUMWDRG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CCCC(=O)O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid? |
| A: The English name of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid is 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid. |
| Q: What is the Chinese name of 2296957-33-8? |
| A: Chinese name of 2296957-33-8 is 2296957-33-8. |
| Q: What is the molecular weight of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid? |
| A: Molecular weight of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid is 271.35. |
| Q: What is the InChIKey of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid? |
| A: InChIKey of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid is AMXZHUBHUMWDRG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid? |
| A: CAS number of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid is 2296957-33-8. |
| Q: What is the molecular formula of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid? |
| A: Molecular formula of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid is C14H25NO4. |
| Q: What is the SMILES notation of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid? |
| A: SMILES notation of 4-(3-{[(Tert-butoxy)carbonyl]amino}cyclopentyl)butanoic acid is CC(C)(C)OC(=O)NC1CCC(CCCC(=O)O)C1. |