[(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate
![[(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate Structure](https://image.chemsrc.com/caspic/345/2297-69-0.png)
[(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate structure
|
Common Name | [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate | ||
|---|---|---|---|---|
| CAS Number | 2297-69-0 | Molecular Weight | 193.15600 | |
| Density | 1.27g/cm3 | Boiling Point | 279.4ºC at 760 mmHg | |
| Molecular Formula | C9H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.5ºC | |
Summary: (4,5-Dioxocyclohepta-2,6-dien-1-ylidene)acetate, Chinese name: (4,5-二氧杂庚环-2,6-二烯-1-基)乙酸盐, CAS number: 2297-69-0, molecular formula: C9H7NO4. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 279.4ºC at 760 mmHg |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.15600 |
| Flash Point | 130.5ºC |
| Exact Mass | 193.03800 |
| PSA | 72.80000 |
| LogP | 0.16970 |
| Vapour Pressure | 0.00404mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | VKYWUUUJICLJFK-UHFFFAOYSA-N |
| SMILES | CC(=O)ON=C1C=CC(=O)C(=O)C=C1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2925290090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
[(4,5-dioxocycl... CAS#:2297-69-0 |
| Literature: Sato, Ohki; Tsurumaki, Kouichiro; Tamaru, Syunnichi; Tsunetsugu, Josuke Heterocycles, 2004 , vol. 62, p. 535 - 542 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| t0513-3844 |
| rch-177 |
| 3,6-cycloheptadiene-1,2,5-trione,5-o-acetyloxime |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate? |
| A: InChIKey of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate is VKYWUUUJICLJFK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate? |
| A: SMILES notation of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate is CC(=O)ON=C1C=CC(=O)C(=O)C=C1. |
| Q: What is the molecular formula of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate? |
| A: Molecular formula of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate is C9H7NO4. |
| Q: What is the polar surface area (PSA) of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate? |
| A: Polar surface area (PSA) of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate is 72.80000. |
| Q: What is the Chinese name of 2297-69-0? |
| A: Chinese name of 2297-69-0 is 2297-69-0. |
| Q: What is the molecular weight of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate? |
| A: Molecular weight of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate is 193.15600. |
| Q: What English synonyms does [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate have? |
| A: English synonyms of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate: t0513-3844, rch-177, 3,6-cycloheptadiene-1,2,5-trione,5-o-acetyloxime. |
| Q: What is the LogP of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate? |
| A: LogP of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate is 0.16970. |
| Q: What is the boiling point of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate? |
| A: Boiling point of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate is 279.4ºC at 760 mmHg. |
| Q: What are the upstream materials of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate? |
| A: Related upstream materials(CAS) of [(4,5-dioxocyclohepta-2,6-dien-1-ylidene)amino] acetate: 2297-94-1;108-24-7. |