4,4'-dimethylangelicin structure
|
Common Name | 4,4'-dimethylangelicin | ||
|---|---|---|---|---|
| CAS Number | 22975-76-4 | Molecular Weight | 214.21700 | |
| Density | 1.273g/cm3 | Boiling Point | 384.4ºC at 760mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.3ºC | |
| Name | 4,9-dimethylfuro[2,3-h]chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 384.4ºC at 760mmHg |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.21700 |
| Flash Point | 186.3ºC |
| Exact Mass | 214.06300 |
| PSA | 43.35000 |
| LogP | 3.15600 |
| Vapour Pressure | 4.11E-06mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | ZUOUYRRXKPHFSV-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2c1ccc1occ(C)c12 |
CHEMICAL IDENTIFICATION
|
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4.5'-Dimethyl-isopsoralen |
| 2H-Furo(2,3-h)(1)benzopyran-2-one,4,9-dimethyl-,plus ultraviolet A radiation |
| 2H-Furo(2,3-h)-1-benzopyran-2-one,4,9-dimethyl-(8CI,9CI) |
| 4,9-dimethyl-furo[2,3-h]chromen-2-one |
| 4,4'-Dimethylisopsoralen plus ultraviolet a radiation |
| 4,9-Dimethyl-2H-furo(2,3-h)-1-benzopyran-2-one plus ultraviolet a radiation |
| 4,4'-DIMETHYLANGELICIN |
| 4,9-Dimethyl-furo[2,3-h]chromen-2-on |
| 4,4'-Dimethylangelicin plus ultraviolet a radiation |
| 4,4'-Dimethylisopsoralen |