2-Chloro-N-(4-hydroxyphenyl)-5-nitrobenzamide structure
|
Common Name | 2-Chloro-N-(4-hydroxyphenyl)-5-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 22978-55-8 | Molecular Weight | 292.67500 | |
| Density | 1.536g/cm3 | Boiling Point | 415.3ºC at 760mmHg | |
| Molecular Formula | C13H9ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205ºC | |
| Name | 2-Chloro-N-(4-hydroxyphenyl)-5-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.536g/cm3 |
|---|---|
| Boiling Point | 415.3ºC at 760mmHg |
| Molecular Formula | C13H9ClN2O4 |
| Molecular Weight | 292.67500 |
| Flash Point | 205ºC |
| Exact Mass | 292.02500 |
| PSA | 95.15000 |
| LogP | 3.80230 |
| Vapour Pressure | 1.72E-07mmHg at 25°C |
| Index of Refraction | 1.706 |
| InChIKey | CGKVYRMRNZJQNG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(O)cc1)c1cc([N+](=O)[O-])ccc1Cl |
| HS Code | 2924299090 |
|---|
|
~73%
2-Chloro-N-(4-h... CAS#:22978-55-8 |
| Literature: SANKYO COMPANY, LIMITED Patent: US2003/134859 A1, 2003 ; |
|
~65%
2-Chloro-N-(4-h... CAS#:22978-55-8 |
| Literature: Kumar, Anil; Narasimhan, Balasubramanian; Kumar, Devinder Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 12 p. 4113 - 4124 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-Hydroxy-2-chlor-5-nitrobenzanilid |