2-[1-(4-methylphenyl)ethoxycarbonyl]benzoic acid
Modify Date: 2025-08-26 19:27:00
![2-[1-(4-methylphenyl)ethoxycarbonyl]benzoic acid Structure](https://image.chemsrc.com/caspic/340/23005-56-3.png)
2-[1-(4-methylphenyl)ethoxycarbonyl]benzoic acid structure
|
Common Name | 2-[1-(4-methylphenyl)ethoxycarbonyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 23005-56-3 | Molecular Weight | 284.30700 | |
| Density | 1.214g/cm3 | Boiling Point | 451.8ºC at 760mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.2ºC | |
| Name | 2-[1-(4-methylphenyl)ethoxycarbonyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 451.8ºC at 760mmHg |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.30700 |
| Flash Point | 165.2ºC |
| Exact Mass | 284.10500 |
| PSA | 63.60000 |
| LogP | 3.61120 |
| Vapour Pressure | 5.97E-09mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | JSIGNCSNGUIZKU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)OC(=O)c2ccccc2C(=O)O)cc1 |
|
~%
2-[1-(4-methylp... CAS#:23005-56-3 |
| Literature: Stein, Allan R.; Dawe, Robert D.; Sweet, James R. Canadian Journal of Chemistry, 1985 , vol. 63, p. 3442 - 3448 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-p-tolylethyl acid phthalate |
| 1-p-Methylphenylethanol |
| Phthalsaeurehalbester |