3-Fluoro-5-vinyl-benzoic acid tert-butyl ester
Modify Date: 2026-09-28 15:41:48
3-Fluoro-5-vinyl-benzoic acid tert-butyl ester structure
|
Common Name | 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 2301068-25-5 | Molecular Weight | 222.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15FO2 |
|---|---|
| Molecular Weight | 222.25 |
| InChIKey | IHNJARMIAGNGDU-UHFFFAOYSA-N |
| SMILES | C=Cc1cc(F)cc(C(=O)OC(C)(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester? |
| A: The English name of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester is 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester. |
| Q: What is the molecular weight of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester? |
| A: Molecular weight of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester is 222.25. |
| Q: What is the CAS number of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester? |
| A: CAS number of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester is 2301068-25-5. |
| Q: What is the InChIKey of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester? |
| A: InChIKey of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester is IHNJARMIAGNGDU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester? |
| A: SMILES notation of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester is C=Cc1cc(F)cc(C(=O)OC(C)(C)C)c1. |
| Q: What is the molecular formula of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester? |
| A: Molecular formula of 3-Fluoro-5-vinyl-benzoic acid tert-butyl ester is C13H15FO2. |
| Q: What is the Chinese name of 2301068-25-5? |
| A: Chinese name of 2301068-25-5 is 2301068-25-5. |