Formamide,N-[2-(1,4-dimethyl-2-dibenzofuranyl)ethyl]- structure
|
Common Name | Formamide,N-[2-(1,4-dimethyl-2-dibenzofuranyl)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 23018-30-6 | Molecular Weight | 267.32200 | |
| Density | 1.17g/cm3 | Boiling Point | 507.4ºC at 760 mmHg | |
| Molecular Formula | C17H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.6ºC | |
| Name | N-(2-(1,4-dimethyldibenzo[b,d]furan-2-yl)ethyl)formamide |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 507.4ºC at 760 mmHg |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.32200 |
| Flash Point | 260.6ºC |
| Exact Mass | 267.12600 |
| PSA | 42.24000 |
| LogP | 4.51810 |
| Vapour Pressure | 2.04E-10mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | DENLKIAQDWKDIA-UHFFFAOYSA-N |
| SMILES | Cc1cc(CCNC=O)c(C)c2c1oc1ccccc12 |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |