2,5-Cyclohexadiene-1,4-dione,2,5-dichloro-3,6-bis(diethylamino)- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-dichloro-3,6-bis(diethylamino)- | ||
|---|---|---|---|---|
| CAS Number | 23019-38-7 | Molecular Weight | 319.22700 | |
| Density | 1.24g/cm3 | Boiling Point | 363.8ºC at 760 mmHg | |
| Molecular Formula | C14H20Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.8ºC | |
| Name | 2,5-dichloro-3,6-bis(diethylamino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 363.8ºC at 760 mmHg |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.22700 |
| Flash Point | 173.8ºC |
| Exact Mass | 318.09000 |
| PSA | 40.62000 |
| LogP | 2.72260 |
| Vapour Pressure | 1.75E-05mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | OQOOCJFEYRUERJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(Cl)C(=O)C(N(CC)CC)=C(Cl)C1=O |
| HS Code | 2922399090 |
|---|
|
~86%
2,5-Cyclohexadi... CAS#:23019-38-7 |
| Literature: Awad, Boshra M.; Sayed, Nadia I. Abdel; Nassar, Ekhlass M. Egyptian Journal of Chemistry, 2000 , vol. 43, # 6 p. 467 - 482 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-Dichloro-3,6-bis(diethylamino)-p-benzoquinone |
| 2,4-DICHLOROPHENOXY-3,5,6-D3-ACETIC ACID |
| 2,5-Dichlor-3,6-bis-<diethylamino>-1,4-benzochinon |
| 2,5-Dichlor-3,6-bis-diaethylamino-p-benzochinon |