1H-Pyrrole-2,5-dione,3-(4-bromophenyl)-4-ethoxy- structure
|
Common Name | 1H-Pyrrole-2,5-dione,3-(4-bromophenyl)-4-ethoxy- | ||
|---|---|---|---|---|
| CAS Number | 23019-43-4 | Molecular Weight | 296.11700 | |
| Density | 1.6g/cm3 | Boiling Point | 449.6ºC at 760mmHg | |
| Molecular Formula | C12H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | 3-(4-bromophenyl)-4-ethoxypyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 449.6ºC at 760mmHg |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.11700 |
| Flash Point | 225.7ºC |
| Exact Mass | 294.98400 |
| PSA | 55.40000 |
| LogP | 2.18190 |
| Vapour Pressure | 2.83E-08mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | WJIXMAZAUWXCNA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(c2ccc(Br)cc2)C(=O)NC1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(4-bromophenyl)-4-ethoxy-1h-pyrrole-2,5-dione |