Hydrazinecarboxamide,2-[1-methyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2-propen-1-ylidene] structure
|
Common Name | Hydrazinecarboxamide,2-[1-methyl-3-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2-propen-1-ylidene] | ||
|---|---|---|---|---|
| CAS Number | 2302-89-8 | Molecular Weight | 249.35200 | |
| Density | 1.06g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Semicarbazon des Isojonons |
|---|
| Density | 1.06g/cm3 |
|---|---|
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.35200 |
| Exact Mass | 249.18400 |
| PSA | 67.48000 |
| LogP | 4.20460 |
| Index of Refraction | 1.536 |
| InChIKey | KONFNVUQMJEATQ-LLDULDGKSA-N |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=NNC(N)=O |
|
~%
Hydrazinecarbox... CAS#:2302-89-8 |
| Literature: Buechi; Yang Journal of the American Chemical Society, 1957 , vol. 79, p. 2318,2322 |
|
~%
Hydrazinecarbox... CAS#:2302-89-8 |
| Literature: Buechi; Yang Journal of the American Chemical Society, 1957 , vol. 79, p. 2318,2322 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |