1,3-divinyl-1,3-diphenyl-1,3-dimethyldisilazane structure
|
Common Name | 1,3-divinyl-1,3-diphenyl-1,3-dimethyldisilazane | ||
|---|---|---|---|---|
| CAS Number | 23038-10-0 | Molecular Weight | 309.553 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 337.8±15.0 °C at 760 mmHg | |
| Molecular Formula | C18H23NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1±20.4 °C | |
| Name | [ethenyl-[(ethenyl-methyl-phenylsilyl)amino]-methylsilyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.8±15.0 °C at 760 mmHg |
| Molecular Formula | C18H23NSi2 |
| Molecular Weight | 309.553 |
| Flash Point | 158.1±20.4 °C |
| Exact Mass | 309.136902 |
| PSA | 12.03000 |
| LogP | 7.02 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | QYJHBNLRANFWHO-UHFFFAOYSA-N |
| SMILES | C=C[Si](C)(N[Si](C)(C=C)c1ccccc1)c1ccccc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Dimethyldivinyldiphenyldisilazan |
| Silanamine,1-ethenyl-N-(ethenylmethylphenylsilyl)-1-methyl-1-phenyl |
| 1,3-DIVINYL-1,3-DIPHENYL-1,3-DIMETHYL-DISILAZANE |
| 1,3-Dimethyl-1,3-diphenyl-1,3-divinyldisilazane |
| Disilazane,1,3-dimethyl-1,3-diphenyl-1,3-divinyl-(8CI) |
| 1-Methyl-N-[methyl(phenyl)vinylsilyl]-1-phenyl-1-vinylsilanamine |
| Silanamine, 1-ethenyl-N-(ethenylmethylphenylsilyl)-1-methyl-1-phenyl- |