(3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl
Modify Date: 2025-09-11 16:16:40
(3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl structure
|
Common Name | (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl | ||
|---|---|---|---|---|
| CAS Number | 2304635-18-3 | Molecular Weight | 317.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21BClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21BClNO2 |
|---|---|
| Molecular Weight | 317.6 |
| InChIKey | YMMPCWRYHQIJTE-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cccc(-c3cccnc3)c2)OC1(C)C.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl? |
| A: CAS number of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl is 2304635-18-3. |
| Q: What is the SMILES notation of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl? |
| A: SMILES notation of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl is CC1(C)OB(c2cccc(-c3cccnc3)c2)OC1(C)C.Cl. |
| Q: What is the English name of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl? |
| A: The English name of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl is (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl. |
| Q: What is the molecular formula of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl? |
| A: Molecular formula of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl is C17H21BClNO2. |
| Q: What is the Chinese name of 2304635-18-3? |
| A: Chinese name of 2304635-18-3 is 2304635-18-3. |
| Q: What is the InChIKey of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl? |
| A: InChIKey of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl is YMMPCWRYHQIJTE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl? |
| A: Molecular weight of (3-(Pyridin-3-YL)phenyl)boronic acid pinacol ester hcl is 317.6. |