n-(3-methoxyphenyl)-3-oxo-3-pyridin-3-ylpropanamide structure
|
Common Name | n-(3-methoxyphenyl)-3-oxo-3-pyridin-3-ylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 23059-22-5 | Molecular Weight | 270.28300 | |
| Density | 1.253g/cm3 | Boiling Point | 534.8ºC at 760mmHg | |
| Molecular Formula | C15H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.2ºC | |
| Name | n-(3-methoxyphenyl)-3-oxo-3-pyridin-3-ylpropanamide |
|---|
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 534.8ºC at 760mmHg |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.28300 |
| Flash Point | 277.2ºC |
| Exact Mass | 270.10000 |
| PSA | 68.29000 |
| LogP | 2.37470 |
| Vapour Pressure | 1.63E-11mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | PIFFCRQQXKDXJQ-UHFFFAOYSA-N |
| SMILES | COc1cccc(NC(=O)CC(=O)c2cccnc2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |