(4-PYRROL-1-YL-PHENYL)-ACETIC ACID structure
|
Common Name | (4-PYRROL-1-YL-PHENYL)-ACETIC ACID | ||
|---|---|---|---|---|
| CAS Number | 230646-18-1 | Molecular Weight | 193.24200 | |
| Density | 1.109g/cm3 | Boiling Point | 284.6ºC at 760 mmHg | |
| Molecular Formula | C11H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.9ºC | |
| Name | 2-(dimethylamino)-2-(4-methylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 284.6ºC at 760 mmHg |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.24200 |
| Flash Point | 125.9ºC |
| Exact Mass | 193.11000 |
| PSA | 40.54000 |
| LogP | 1.68230 |
| Vapour Pressure | 0.00138mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | FPPJNXPDVUZZPS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C(=O)O)N(C)C)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Dimethylamino-p-tolylacetic acid |