H-Gly-Trp-Gly-OH structure
|
Common Name | H-Gly-Trp-Gly-OH | ||
|---|---|---|---|---|
| CAS Number | 23067-32-5 | Molecular Weight | 318.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Gly-Trp-Gly-OHH-Gly-Trp-Gly-OH is a polypeptide[1]. |
| Name | 2-[[2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | H-Gly-Trp-Gly-OH is a polypeptide[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H18N4O4 |
|---|---|
| Molecular Weight | 318.32800 |
| Exact Mass | 318.13300 |
| PSA | 137.31000 |
| LogP | 0.83680 |
| InChIKey | PYFIQROSWQERAS-LBPRGKRZSA-N |
| SMILES | NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Trp-gly-gly |
| Glycyl-L-tryptophanylglycine |
| Glycine,glycyl-L-tryptophyl |
| gly-trpH-gly |
| Glycyl-L-tryptophylglycine |
| H-Gly-Trp-Gly-OH |
| Glycyltryptophylglycine |