5-(dimethylamino)-2-methylisoindole-1,3-dione structure
|
Common Name | 5-(dimethylamino)-2-methylisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 2307-01-9 | Molecular Weight | 204.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(dimethylamino)-2-methylisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12N2O2 |
|---|---|
| Molecular Weight | 204.22500 |
| Exact Mass | 204.09000 |
| PSA | 40.62000 |
| LogP | 0.91630 |
| InChIKey | KSEJNTBYAJRFMU-UHFFFAOYSA-N |
| SMILES | CN1C(=O)c2ccc(N(C)C)cc2C1=O |
|
~%
5-(dimethylamin... CAS#:2307-01-9 |
| Literature: Okamoto, Hideki; Kohno, Mami; Satake, Kyosuke; Kimura, Masaru Bulletin of the Chemical Society of Japan, 2005 , vol. 78, # 12 p. 2180 - 2187 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Dimethylamino-N-methyl-phthalimide |
| HMS2290A14 |
| 5-Dimethylamino-2-methyl-isoindolin-1,3-dion |
| 5-dimethylamino-2-methyl-isoindole-1,3-dione |
| 5-dimethylamino-2-methyl-isoindoline-1,3-dione |