1-fluoro-1,1,2,2,2-pentanitroethane structure
|
Common Name | 1-fluoro-1,1,2,2,2-pentanitroethane | ||
|---|---|---|---|---|
| CAS Number | 23072-51-7 | Molecular Weight | 273.04700 | |
| Density | 2.084g/cm3 | Boiling Point | 45.6ºC at 760 mmHg | |
| Molecular Formula | C2FN5O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-fluoro-1,1,2,2,2-pentanitroethane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.084g/cm3 |
|---|---|
| Boiling Point | 45.6ºC at 760 mmHg |
| Molecular Formula | C2FN5O10 |
| Molecular Weight | 273.04700 |
| Exact Mass | 272.96300 |
| PSA | 229.10000 |
| LogP | 1.26300 |
| Vapour Pressure | 347mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | QXCMLBSYQBLNDK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(F)([N+](=O)[O-])C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Fluoropentanitroethan |
| Ethane,1-fluoro-1,1,2,2,2-pentanitro |
| fluoro-pentanitro-ethane |
| Fluor-pentanitroaethan |