4'-Chloro-2-hydroxycarbazole-1-carboxanilide
Modify Date: 2024-04-04 21:06:02
4'-Chloro-2-hydroxycarbazole-1-carboxanilide structure
|
Common Name | 4'-Chloro-2-hydroxycarbazole-1-carboxanilide | ||
|---|---|---|---|---|
| CAS Number | 23077-61-4 | Molecular Weight | 336.77200 | |
| Density | 1.495 g/cm3 | Boiling Point | 512.5ºC at 760 mmHg | |
| Molecular Formula | C19H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.8ºC | |
| Name | N-(4-chlorophenyl)-2-hydroxy-9H-carbazole-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.495 g/cm3 |
|---|---|
| Boiling Point | 512.5ºC at 760 mmHg |
| Molecular Formula | C19H13ClN2O2 |
| Molecular Weight | 336.77200 |
| Flash Point | 263.8ºC |
| Exact Mass | 336.06700 |
| PSA | 65.12000 |
| LogP | 5.00540 |
| Vapour Pressure | 4E-11mmHg at 25°C |
| Index of Refraction | 1.816 |
| InChIKey | AIYBQVVTHZHPDG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1c(O)ccc2c1[nH]c1ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
4'-Chloro-2-hyd... CAS#:23077-61-4 |
| Literature: Journal of the Society of Dyers and Colourists, , vol. 54, p. 422,424 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9H-Carbazole-1-carboxamide,N-(4-chlorophenyl)-2-hydroxy |
| 1-(4-Chlor-phenylcarbamoyl)-2-hydroxy-carbazol |
| 4'-chloro-2-hydroxycarbazole-1-carboxanilide |
| EINECS 245-419-1 |
| Naphthol AS-LB |
| 2-hydroxy-carbazole-1-carboxylic acid-(4-chloro-anilide) |
| 2-Hydroxy-carbazol-1-carbonsaeure-(4-chlor-anilid) |