3,4-Dimethylhippuric Acid structure
|
Common Name | 3,4-Dimethylhippuric Acid | ||
|---|---|---|---|---|
| CAS Number | 23082-12-4 | Molecular Weight | 207.22600 | |
| Density | 1.194 g/cm3 | Boiling Point | 406.2ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | 160ºC | |
| MSDS | N/A | Flash Point | 199.4ºC | |
Use of 3,4-Dimethylhippuric Acid |
| Name | 2-[(3,4-dimethylbenzoyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194 g/cm3 |
|---|---|
| Boiling Point | 406.2ºC at 760 mmHg |
| Melting Point | 160ºC |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 199.4ºC |
| Exact Mass | 207.09000 |
| PSA | 66.40000 |
| LogP | 1.50870 |
| Vapour Pressure | 2.51E-07mmHg at 25°C |
| InChIKey | ZDHXVMSVUHHHAE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)NCC(=O)O)cc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,4-Dimethylhippuric acid |
| 3,4-DIMETHYLHIPPURIC ACID |