N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide
Modify Date: 2026-07-16 15:13:56
![N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide Structure](https://www.chemsrc.com/extcaspic/463/2308317-15-7.png)
N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide structure
|
Common Name | N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 2308317-15-7 | Molecular Weight | 239.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13N3O2S |
|---|---|
| Molecular Weight | 239.30 |
| InChIKey | SZEXQEYBFUTRGW-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Nc1nnc(C2CCOCC2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2308317-15-7? |
| A: Chinese name of 2308317-15-7 is 2308317-15-7. |
| Q: What is the English name of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide? |
| A: The English name of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide is N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide. |
| Q: What is the InChIKey of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide? |
| A: InChIKey of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide is SZEXQEYBFUTRGW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide? |
| A: Molecular weight of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide is 239.30. |
| Q: What is the molecular formula of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide? |
| A: Molecular formula of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide is C10H13N3O2S. |
| Q: What is the SMILES notation of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide? |
| A: SMILES notation of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide is C=CC(=O)Nc1nnc(C2CCOCC2)s1. |
| Q: What is the CAS number of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide? |
| A: CAS number of N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide is 2308317-15-7. |