N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide
Modify Date: 2025-09-04 11:03:30
![N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide Structure](https://www.chemsrc.com/extcaspic/108/2308317-60-2.png)
N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide structure
|
Common Name | N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 2308317-60-2 | Molecular Weight | 248.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17FN2O |
|---|---|
| Molecular Weight | 248.30 |
| InChIKey | ZKOZZCLHOPOAEP-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NCc1c(F)cccc1N1CCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide? |
| A: CAS number of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide is 2308317-60-2. |
| Q: What is the molecular formula of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide? |
| A: Molecular formula of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide is C14H17FN2O. |
| Q: What is the InChIKey of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide? |
| A: InChIKey of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide is ZKOZZCLHOPOAEP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide? |
| A: Molecular weight of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide is 248.30. |
| Q: What is the SMILES notation of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide? |
| A: SMILES notation of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide is C=CC(=O)NCc1c(F)cccc1N1CCCC1. |
| Q: What is the Chinese name of 2308317-60-2? |
| A: Chinese name of 2308317-60-2 is 2308317-60-2. |
| Q: What is the English name of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide? |
| A: The English name of N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide is N-{[2-fluoro-6-(pyrrolidin-1-yl)phenyl]methyl}prop-2-enamide. |