2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Modify Date: 2025-09-09 23:47:29
2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane structure
|
Common Name | 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | ||
|---|---|---|---|---|
| CAS Number | 2308450-25-9 | Molecular Weight | 214.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H23BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H23BO3 |
|---|---|
| Molecular Weight | 214.11 |
| InChIKey | ZCUZASBWRILIOM-UHFFFAOYSA-N |
| SMILES | COCCCCB1OC(C)(C)C(C)(C)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: CAS number of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 2308450-25-9. |
| Q: What is the molecular weight of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular weight of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 214.11. |
| Q: What is the molecular formula of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular formula of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is C11H23BO3. |
| Q: What is the Chinese name of 2308450-25-9? |
| A: Chinese name of 2308450-25-9 is 2308450-25-9. |
| Q: What is the English name of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: The English name of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. |
| Q: What is the InChIKey of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: InChIKey of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is ZCUZASBWRILIOM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: SMILES notation of 2-(4-Methoxybutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is COCCCCB1OC(C)(C)C(C)(C)O1. |