2-Propenoic acid, 3-[4- (acetyloxy)-3-methoxyphenyl]-, methyl ester structure
|
Common Name | 2-Propenoic acid, 3-[4- (acetyloxy)-3-methoxyphenyl]-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 2309-08-2 | Molecular Weight | 250.24700 | |
| Density | 1.18g/cm3 | Boiling Point | 348ºC at 760 mmHg | |
| Molecular Formula | C13H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
| Name | methyl (E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 348ºC at 760 mmHg |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.24700 |
| Flash Point | 152.4ºC |
| Exact Mass | 250.08400 |
| PSA | 61.83000 |
| LogP | 1.80670 |
| Vapour Pressure | 5.17E-05mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | HLCZBCWZTSEZGB-FNORWQNLSA-N |
| SMILES | COC(=O)C=Cc1ccc(OC(C)=O)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
2-Propenoic aci... CAS#:2309-08-2 |
| Literature: Pacsu; Stieber Chemische Berichte, 1929 , vol. 62, p. 2977 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| acetylated methyl ferulate |
| Cinnamic acid,methyl ester,acetate |
| Cinnamic acid,4-hydroxy-3-methoxy-,methyl ester,acetate |
| 4-Acetoxy-3-methoxy-zimtsaeure-methylester |
| methyl 4-acetoxy-3-methoxycinnamate |
| Acetylferulasaeure-methylester |
| 4-acetoxy-3-methoxy-cinnamic acid methyl ester |