tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate
Modify Date: 2026-09-30 17:14:59
![tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate Structure](https://www.chemsrc.com/extcaspic/182/2309446-87-3.png)
tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate structure
|
Common Name | tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate | ||
|---|---|---|---|---|
| CAS Number | 2309446-87-3 | Molecular Weight | 388.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26BrN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H26BrN3O3 |
|---|---|
| Molecular Weight | 388.30 |
| InChIKey | HSLUSSQQOCMVRI-UHFFFAOYSA-N |
| SMILES | Cn1cc(Br)nc1C1(OCC(=O)OC(C)(C)C)CCCNCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate? |
| A: InChIKey of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate is HSLUSSQQOCMVRI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate? |
| A: Molecular weight of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate is 388.30. |
| Q: What is the English name of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate? |
| A: The English name of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate is tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate. |
| Q: What is the Chinese name of 2309446-87-3? |
| A: Chinese name of 2309446-87-3 is 2309446-87-3. |
| Q: What is the SMILES notation of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate? |
| A: SMILES notation of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate is Cn1cc(Br)nc1C1(OCC(=O)OC(C)(C)C)CCCNCC1. |
| Q: What is the molecular formula of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate? |
| A: Molecular formula of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate is C16H26BrN3O3. |
| Q: What is the CAS number of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate? |
| A: CAS number of tert-butyl 2-{[4-(4-bromo-1-methyl-1H-imidazol-2-yl)azepan-4-yl]oxy}acetate is 2309446-87-3. |