3'-Methoxy-2-methyl[1,1'-biphenyl]-4-amine structure
|
Common Name | 3'-Methoxy-2-methyl[1,1'-biphenyl]-4-amine | ||
|---|---|---|---|---|
| CAS Number | 230962-39-7 | Molecular Weight | 213.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3'-Methoxy-2-methyl[1,1'-biphenyl]-4-amine |
|---|
| Molecular Formula | C14H15NO |
|---|---|
| Molecular Weight | 213.27500 |
| Exact Mass | 213.11500 |
| PSA | 35.25000 |
| LogP | 3.83400 |
| InChIKey | BBULYSOVXVHCEB-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2ccc(N)cc2C)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |