4-Benzyl-1-piperazinecarbothioamide structure
|
Common Name | 4-Benzyl-1-piperazinecarbothioamide | ||
|---|---|---|---|---|
| CAS Number | 23111-81-1 | Molecular Weight | 235.34800 | |
| Density | 1.218g/cm3 | Boiling Point | 359.5ºC at 760mmHg | |
| Molecular Formula | C12H17N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.2ºC | |
| Name | 4-benzylpiperazine-1-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 359.5ºC at 760mmHg |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.34800 |
| Flash Point | 171.2ºC |
| Exact Mass | 235.11400 |
| PSA | 69.13000 |
| LogP | 1.64430 |
| Vapour Pressure | 2.37E-05mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | ZBNQVYYPSOUTOC-UHFFFAOYSA-N |
| SMILES | NC(=S)N1CCN(Cc2ccccc2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-benzyl-piperazine-carbothioic acid amide |
| 4-benzyl-piperazine-1-carbothioic acid amide |
| 4-benzyl-1-piperazinylthiocarboxamide |
| 1-Aminothiocarbonyl-4-benzylpiperazin |