Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate structure
|
Common Name | Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 23112-97-2 | Molecular Weight | 292.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H16N2O2 |
|---|---|
| Molecular Weight | 292.3 |
| InChIKey | SIUVYXMPRCUSFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]nc2c1CCc1c-2ccc2ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate? |
| A: SMILES notation of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate is CCOC(=O)c1[nH]nc2c1CCc1c-2ccc2ccccc12. |
| Q: What is the CAS number of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate? |
| A: CAS number of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate is 23112-97-2. |
| Q: What is the molecular formula of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate? |
| A: Molecular formula of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate is C18H16N2O2. |
| Q: What is the molecular weight of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate? |
| A: Molecular weight of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate is 292.3. |
| Q: What is the Chinese name of 23112-97-2? |
| A: Chinese name of 23112-97-2 is 23112-97-2. |
| Q: What is the InChIKey of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate? |
| A: InChIKey of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate is SIUVYXMPRCUSFW-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate? |
| A: The English name of Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate is Ethyl 10,11-dihydro-3H-naphth[1,2-g]indazole-1-carboxylate. |