N-[1-(Chloromethyl)propyl]carbamic acid 3-methoxycarbonylaminophenyl ester structure
|
Common Name | N-[1-(Chloromethyl)propyl]carbamic acid 3-methoxycarbonylaminophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 23121-99-5 | Molecular Weight | 300.73800 | |
| Density | 1.271g/cm3 | Boiling Point | 372.384ºC at 760 mmHg | |
| Molecular Formula | C13H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.012ºC | |
| Name | chlorprocarb |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 372.384ºC at 760 mmHg |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.73800 |
| Flash Point | 179.012ºC |
| Exact Mass | 300.08800 |
| PSA | 83.64000 |
| LogP | 3.18870 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | CYDCAYZRTPOUJJ-UHFFFAOYSA-N |
| SMILES | CCC(CCl)NC(=O)Oc1cccc(NC(=O)OC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl (RS)-3-[1-(chloromethyl)propylcarbamoyloxy]carbanilate |
| 3-[(methoxycarbonyl)amino]phenyl N-[1-(chloromethyl)propyl]carbamate |
| rac-3-(methoxyformamido)phenyl [(2R)-1-chlorobutan-2-yl]carbamate |
| [3-(methoxycarbonylamino)phenyl] N-(1-chlorobutan-2-yl)carbamate |
| Chlorprocarb |