ethyl 3-acetyl-2,5-dihydro-4-hydroxy-5-oxo-2-(2-oxopropyl)-2-furoate structure
|
Common Name | ethyl 3-acetyl-2,5-dihydro-4-hydroxy-5-oxo-2-(2-oxopropyl)-2-furoate | ||
|---|---|---|---|---|
| CAS Number | 23127-85-7 | Molecular Weight | 270.23500 | |
| Density | 1.368g/cm3 | Boiling Point | 472.7ºC at 760mmHg | |
| Molecular Formula | C12H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.7ºC | |
| Name | ethyl 3-acetyl-4-hydroxy-5-oxo-2-(2-oxopropyl)furan-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 472.7ºC at 760mmHg |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.23500 |
| Flash Point | 181.7ºC |
| Exact Mass | 270.07400 |
| PSA | 106.97000 |
| LogP | 0.22530 |
| Vapour Pressure | 6.39E-11mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | ZWNGEJXPRFXVOE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC(C)=O)OC(=O)C(O)=C1C(C)=O |
| HS Code | 2932190090 |
|---|
|
~%
ethyl 3-acetyl-... CAS#:23127-85-7 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2009/32667 A1, 2009 ; Location in patent: Page/Page column 135-135 ; WO 2009/032667 A1 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| einecs 245-440-6 |