1-Methyl-1-nitroso-3-(p-bromophenyl)urea
Modify Date: 2025-09-20 18:40:15
1-Methyl-1-nitroso-3-(p-bromophenyl)urea structure
|
Common Name | 1-Methyl-1-nitroso-3-(p-bromophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 23139-02-8 | Molecular Weight | 258.07200 | |
| Density | 1.61g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H8BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-bromophenyl)-1-methyl-1-nitrosourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Molecular Formula | C8H8BrN3O2 |
| Molecular Weight | 258.07200 |
| Exact Mass | 256.98000 |
| PSA | 61.77000 |
| LogP | 2.66720 |
| Index of Refraction | 1.62 |
| InChIKey | XSHFAQXUVMJKGJ-UHFFFAOYSA-N |
| SMILES | CN(N=O)C(=O)Nc1ccc(Br)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-<4-Brom-phenyl>-N'-methyl-N'-nitroso-harnstoff |