2,5-Pyrrolidinedione,1-(4-methoxyphenyl)- structure
|
Common Name | 2,5-Pyrrolidinedione,1-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2314-80-9 | Molecular Weight | 205.21000 | |
| Density | 1.274g/cm3 | Boiling Point | 456.8ºC at 760mmHg | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230ºC | |
| Name | 1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 456.8ºC at 760mmHg |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21000 |
| Flash Point | 230ºC |
| Exact Mass | 205.07400 |
| PSA | 46.61000 |
| LogP | 1.41360 |
| Vapour Pressure | 1.57E-08mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | MHZVVJBHJQRDQI-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2C(=O)CCC2=O)cc1 |
| HS Code | 2925190090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| hms2412n21 |