1,3-DIMETHYL-7-(OXIRAN-2-YLMETHYL)-2,3,6,7-TETRAHYDRO-1H-PURINE-2,6-DIONE structure
|
Common Name | 1,3-DIMETHYL-7-(OXIRAN-2-YLMETHYL)-2,3,6,7-TETRAHYDRO-1H-PURINE-2,6-DIONE | ||
|---|---|---|---|---|
| CAS Number | 23146-07-8 | Molecular Weight | 236.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dimethyl-7-(oxiran-2-ylmethyl)purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12N4O3 |
|---|---|
| Molecular Weight | 236.22700 |
| Exact Mass | 236.09100 |
| PSA | 74.35000 |
| InChIKey | RRDOLZNTXDQLHT-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC2CO2)N(C)C1=O |
|
~73%
1,3-DIMETHYL-7-... CAS#:23146-07-8 |
| Literature: El Ashry, El Sayed; Abdel-Rahman, Adel; Rashed, Nagwa; Awad, Laila; Rasheed, Hanaa Nucleosides, Nucleotides and Nucleic Acids, 2006 , vol. 25, # 3 p. 299 - 305 |
|
~%
1,3-DIMETHYL-7-... CAS#:23146-07-8 |
| Literature: Parikh et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 2778,2781 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1,3-dimethyl-7-oxiranylmethyl-3,7-dihydro-purine-2,6-dione |
| 7-<2,3-Epoxy-propyl>-theophyllin |
| 1,3-Dimethyl-7-oxiranylmethyl-3,7-dihydro-purin-2,6-dion |